Mineral Converter

Please use our AVS converter to calculate conversion rates of Minerals

Borax (% B = 11.34)
Mol.Fml.Na2B4O7.10H20
Mol.Wt. 381.4
 mg Calculate
Boric acid (% B = 17.48)
Mol.Fml.H3BO3
Mol.Wt. 61.83
 mg Calculate
Borax pentahydrate (% B = 14.84)
Mol.Fml.Na2B4O7.5H20
Mol.Wt.291.3
 mg Calculate
Sodium perborate (% B = 7.02)
Mol.Fml.NaBH2O43H20
Mol.Wt.153.9
 mg Calculate

Calcium ascorbate ( % Ca = 10.27)
Mol.Fml. C12H14CaO12
Mol.Wt.390.3
 mg Calculate
Calcium ascorbate dihydrate (% Ca = 9.4)
Mol.Fml. C12H14CaO12.2H2O
Mol.Wt. 426.3
 mg Calculate
Calcium carbonate (% Ca= 40.0)
Mol.Fml.CaCO3
Mol.Wt. 100.1
 mg Calculate
Calcium citrate hydrate (% Ca = 21.1)
Mol.Fml.C12H10Ca3O14.4H2O
Mol.Wt. 570.4
 mg Calculate
Calcium citrate (% Ca = 24.1)
Mol.Fml.C12H10Ca3O14
Mol.Wt. 498.4
 mg Calculate
Calcium fluoride (% Ca = 51.3)
Mol.Fml.CaF2
Mol.Wt.78.1
 mg Calculate
Calcium gluconate (% Ca = 8.9)
Mol.Fml.C12H22CaO14.H2O
Mol.Wt.448.4
 mg Calculate
 
Calcium glycerophosphate (% Ca = 19.1, % P =14.7)
Mol.Fml.C3H7CaO6P
Mol.Wt.210.1
 mg Calculate
 mg Calcium
 mg Phosphorus
Calcium hydrogen phosphate (% Ca = 23.3, % P = 18.0)
Mol.Fml.CaHPO4.2H2O
Mol.Wt.172.1
 mg Calculate
 mg Calcium
 mg Phosphorus
Calcium hydrogen phosphate anhydrous (% Ca = 29.5, % P= 22.8)
Mol.Fml.CaHPO4
Mol.Wt.136.1
 mg Calculate
 mg Calcium
 mg Phosphorus
Calcium hydrogen phosphate monohydrate (% Ca = 26, % P = 20.1)
Mol.Fml.CaHPO4.H2O
Mol.Wt.154.1
 mg Calculate
 mg Calcium
 mg Phosphorus
Calcium lactate anhydrous (% Ca = 18.37)
Mol.Fml.C6H10CaO6
Mol.Wt.218.2
 mg Calculate
Calcium lactate gluconate (% Ca = 12.92)
Mol.Fml. Ca5(C3H5O3)6.(C6H11O7)4.2H20
Mol.Wt.1551.4
 mg Calculate
Calcium lactate pentahydrate (% Ca = 13.0)
Mol.Fml.C6H10CaO6. 5H20
Mol.Wt.308.2
 mg Calculate
Calcium lactate trihydrate (% Ca = 14.7)
Mol.Fml.C6H10CaO6.3H20
Mol.Wt.272.2
 mg Calculate
Calcium phosphate (% Ca = 39.9, % P = 18.5)
Mol.Fml.Ca5(OH)(PO4)3
Mol.Wt.502.3
 mg Calculate
 mg Calcium
 mg Phosphorus
Calcium sodium lactate (% Ca = 7.8, % Na = 8.9)
Mol.Fml.2C3H5NaO3.(C3H5O3)2Ca.4H20
Mol.Wt.514.4
 mg Calculate
 mg Calcium
 mg Phosphorus
Calcium succinate (% Ca = 25.7)
Mol.Fml.C4H4CaO4
Mol.Wt.156.2
 mg Calculate
Calcium sulfate (% Ca = 23.3)
Mol.Fml.CaSO4.2H2O
Mol.Wt.172.2
 mg Calculate
Calcium sulfate anhydrous (% Ca = 29.4)
Mol.Fml.CaSO4
Mol.Wt.136.1
 mg Calculate
Calcium sulfate - dried (% Ca = 27.6)
Mol.Fml.CaSO4.1/2H2O
Mol.Wt.145.1
 mg Calculate
Calcium Orotate (% Ca = 11.4)
Mol.Fml.C10H6N4CaO8
Mol.Wt.350.2
 mg Calculate

Chromic chloride (% Cr = 19.5)
Mol.Fml.CrCl3.6H2O
Mol.Wt. 266.4
 mg Calculate
Chromium nicotinate (% Cr = 12.4)
Mol.Fml.C18H12CrN3O6
Mol.Wt. 418.3
 mg Calculate
Chromium picolinate (% Cr =12.43)
Mol.Fml.Cr(C6H4NO2)
Mol.Wt. 418.3
 mg Calculate

Ferrous carbonate (% Fe = 48.2)
Mol.Fml.FeCO3
Mol.Wt. 115.85
 mg Calculate
Ferric chloride anhydrous (% Fe = 34.2)
Mol.Fml.FeCl3
Mol.Wt. 162.3
 mg Calculate
Ferrous chloride (% Fe = 44.1)
Mol.Fml.FeCl2
Mol.Wt. 126.75
 mg Calculate
Ferric chloride hexahydrate (% Fe = 20.7)
Mol.Fml.FeCl3.6H2O
Mol.Wt. 270.3
 mg Calculate
Ferrous fumarate (% Fe = 32.9)
Mol.Fml.C4H2FeO4
Mol.Wt. 169.9
 mg Calculate
Ferrous gluconate (% Fe = 11.6)
Mol.Fml.C12H22FeO14.2H2O
Mol.Wt. 482.1
 mg Calculate
Ferric glycerophosphate (% Fe = 18)
Mol.Fml.C3H9O6P.2/3Fe
 mg Calculate
Ferrous lactate (% Fe = 19.4)
Mol.Fml.C6H10FeO6.3H2O
Mol.Wt. 288
 mg Calculate
Ferric pyrophosphate (% Fe = 30)
Mol.Fml.Fe4O21P6
Mol.Wt. 745.2
 mg Calculate
Ferrous phosphate (% Fe = 33.4)
Mol.Fml.Fe3(PO4)2.8H2O
Mol.Wt.501.6
 mg Calculate
Ferrous succinate (% Fe = 32.5)
Mol.Fml.C4H4FeO4
Mol.Wt.171.92
 mg Calculate
Ferrous sulfate (% Fe = 20.1)
Mol.Fml.FeSO4.7H2O
Mol.Wt.278
 mg Calculate
Ferrous sulfate - dried (% Fe = 32.9)
Mol.Fml.FeSO4.H2O
Mol.Wt.170.0
 mg Calculate
Iron oxide black CI77499 (% Fe = 72.4)
Mol.Fml.Fe3O4
Mol.Wt.231.5
 mg Calculate
Iron oxide red CI77491 (% Fe = 69.9)
Mol.Fml.Fe2O3
Mol.Wt.159.7
 mg Calculate
Iron oxide yellow CI77492 (% Fe = 62.9)
Mol.Fml.FeO(OH).XH2O
Mol.Wt.177.7
 mg Calculate

Magnesium ascorbate (% Mg = 6.5, Ascor = 93.5)
Mol.Fml.(C6H7O6)2Mg
Mol.Wt.374.5
 mg Calculate
mg Magnesium
mg Ascorbic Acid
Magnesium aspartate (% Mg = 7.49)
Mol.Fml.C8H12MgN2O8.2H2O
Mol.Wt.324.5
 mg Calculate
 
Magnesium ascorbate monohydrate (% Mg = 6.2, % Ascor = 89.2)
Mol.Fml.C6H7O6)2Mg.H2O
Mol.Wt.392.5
 mg Calculate
 mg Magnesium
 mg Ascorbic Acid
Magnesium carbonate (% Mg = 25.25)
 mg Calculate
Magnesium carbonate - light (% Mg = 25.75)
 mg Calculate
Magnesium carbonate - heavy (% Mg = 25.75)
 mg Calculate
Magnesium chloride (% Mg =11.96)
Mol.Fml.MgCl2.6H2O
Mol.Wt.203.3
 mg Calculate
Magnesium citrate tetradecahydrate (% Mg = 10.37)
Mol.Fml.C12H10Mg3O14.14H2O
Mol.Wt.703.4
 mg Calculate
Magnesium citrate (% Mg = 16.2)
Mol.Fml.C12H10Mg3O14
Mol.Wt.451.1
 mg Calculate
Magnesium citrate - dibasic (% Mg = 11.3)
Mol.Fml.C6H6MgO7
Mol.Wt.214.4
 mg Calculate
Magnesium gluconate (% Mg = 5.9)
Mol.Fml.C12H22MgO14.XH2O
Mol.Wt.414.6
 mg Calculate
Magnesium glycerophosphate (% Mg = 12.5)
Mol.Fml.C3H7MgO6P
Mol.Wt.194.4
 mg Calculate
Magnesium orotate (% Mg = 7.3)
Mol.Fml.C10H6N4MgO8
Mol.Wt.334.4
 mg Calculate
Magnesium oxide (% Mg = 60.3)
Mol.Fml.MgO
Mol.Wt.40.3
 mg Calculate
Magnesium oxide - heavy (% Mg = 60.3)
Mol.Fml.MgO
Mol.Wt.40.3
 mg Calculate
Magnesium oxide - light (% Mg= 60.3)
Mol.Fml.MgO
Mol.Wt.40.3
 mg Calculate
Magnesium phosphate (% Mg = 20.7, P = 17.6)
Mol.Fml.Mg3(PO4)2.5H2O
Mol.Wt.352.9
 mg Calculate
 mg Magnesium
 mg Phosphorus
Magnesium phosphate - dibasic trihydrate (% Mg = 13.94)
Mol.Fml.MgHPO4.3H2O
Mol.Wt.174.34
 mg Calculate
Magnesium phosphate - tribasic anhydrous (% Mg = 27.7)
Mol.Fml.Mg3(PO4)2
Mol.Wt.262.86
 mg Calculate
Magnesium sulfate (% Mg = 9.9)
Mol.Fml.MgSO4.XH2O
Mol.Wt.246.5
 mg Calculate
Magnesium sulfate - dried (% Mg = 12.6 - 14.2)
Mol.Fml.MgSO4 + water
Mol.Wt.120.4
 mg Calculate
Magnesium sulfate monohydrate (% Mg = 17.6)
Mol.Fml.MgSO4.H2O
Mol.Wt.138.4
 mg Calculate
Magnesium sulfate trihydrate (% Mg = 14)
Mol.Fml.MgSO4.3H2O
Mol.Wt.174.4
 mg Calculate
Magnesium sulfate heptahydrate (% Mg = 9.9)
Mol.Fml.MgSO4.7H2O
Mol.Wt.246.5
 mg Calculate
Magnesium sulfate dihydrate (% Mg = 15.5)
Mol.Fml.MgSO4.2H2O
Mol.Wt.156.4
 mg Calculate
Magnesium orotate dihydrate (% Mg = 6.6)
Mol.Fml.C10H6N4MgO82H20
Mol.Wt.370.4
 mg Calculate

Potassium ascorbate (% K = 18.3, % Ascor = 81.7)
Mol.Fml.C6H8O8K
Mol.Wt.215.1
 mg Calculate
 mg Potassium
 mg Ascorbic Acid
Potassium aspartate (% K = 21.7)
Mol.Fml.C4H6KNO4.1/2H2O
Mol.Wt.180.11
 mg Calculate
Potassium aspartate monohydrate (% K = 20.7)
Mol.Fml.C4H6KNO4.H2O
Mol.Wt.189.11
 mg Calculate
Potassium aspartate dihydrate (% K = 18.9)
Mol.Fml.C4H6KNO4.2H2O
Mol.Wt.207.11
 mg Calculate
Potassium bicarbonate (% K= 39.1)
Mol.Fml.KHCO3
Mol.Wt.100.1
 mg Calculate
Potassium chloride (% K = 52.4)
Mol.Fml.KCl
Mol.Wt.74.6
 mg Calculate
Potassium citrate (% K = 36.2)
Mol.Fml.C6H5K3O7.H2O
Mol.Wt.324.4
 mg Calculate
Potassium gluconate (% K = 16.7)
Mol.Fml.C6H11KO7
Mol.Wt.234.25
 mg Calculate
Potassium glycerophosphate (% P = 12.5, % K = 31.5)
Mol.Fml.C3H7K2O6P
Mol.Wt.248.26
 mg Calculate
 mg Potassium
 mg Phosphorus
Potassium iodide (% K = 23.6, % I = 76.4)
Mol.Fml.KI
Mol.Wt.166.0
 mg Calculate
 mg Potassium
 mg Iodine
Potassium orotate (% K = 20.1)
Mol.Fml.C5H3N2O4K
Mol.Wt.194.1
 mg Calculate
Potassium phosphate - monobasic (% K = 28.7, % P = 22.8)
Mol.Fml.KH2PO4
Mol.Wt.136.1
 mg Calculate
 mg Potassium
 mg Phosphorus
Potassium phosphate - tribasic (% K = 55.26)

Mol.Fml.K3PO4
Mol.Wt.212.27
 mg Calculate
Potassium sulfate (% K = 44.9)
Mol.Fml.K2SO4
Mol.Wt.174.3
 mg Calculate
Potassium ascorbate dihydrate (% K = 15.6, Ascor = 70)
Mol.Fml.C6H8O6K.2H2O
Mol.Wt.251.1
 mg Calculate
 mg Potassium
 mg Ascorbic Acid
Potassium phosphate - dibasic (% K = 44.9, % P= 17.78)
Mol.Fml.K2HPO4
Mol.Wt.174.2
 mg Calculate
 mg Potassium
 mg Phosphorus

Yeast - High Chromium
 mg Calculate
Yeast - High Selenium
 mg Calculate
Yeast - High Molybdenum
 mg Calculate

Zinc ascorbate (% Zn = 15.7, % Ascor = 84.3)
Mol.Fml.C12H14O12Zn
Mol.Wt.415.6
 mg Calculate
 mg Zinc
 mg Ascorbic Acid
Zinc chloride (% Zn = 48.0)
Mol.Fml.ZnCl2
Mol.Wt.136.3
 mg Calculate
Zinc citrate (% Zn = 34.15)
Mol.Fml.C12H10O14Zn3
Mol.Wt.574.36
 mg Calculate
Zinc citrate dihydrate (% Zn = 32.1)
Mol.Fml.C12H10O14Zn3.2H2O
Mol.Wt.610.36
 mg Calculate
Zinc citrate trihydrate (% Zn = 31.21)
Mol.Fml.C12H10O14Zn3.3H2O
Mol.Wt.628.36
 mg Calculate
Zinc gluconate (% Zn = 14.35)
Mol.Fml.C12H22ZnO14
Mol.Wt.455.68
 mg Calculate
Zinc oxide (% Zn = 80.3)
Mol.Fml.ZnO
Mol.Wt.81.39
 mg Calculate
Zinc succinate (% Zn = 35.7)
Mol.Fml.C4H6O4.Zn
Mol.Wt.183.38
 mg Calculate
Zinc sulfate (% Zn = 22.7)
Mol.Fml.ZnSO4.7H2O
Mol.Wt.287.5
 mg Calculate
Zinc sulfate monohydrate (% Zn = 36.4)
Mol.Fml.ZnSO4.H2O
Mol.Wt.179.5
 mg Calculate

Cupric citrate (% Cu = 40.3)
Mol.Fml.C6H4Cu2O7
Mol.Wt. 315.19
 mg Calculate
Copper gluconate (% Cu = 14.0)
Mol.Fml.C12H22CuO14
Mol.Wt. 453.9
 mg Calculate
Cupric oxide (% Cu = 79.89)
Mol.Fml.CuO
Mol.Wt. 79.55
 mg Calculate
Cupric sulfate anhydrous (% Cu = 39.8)
Mol.Fml.CuSO4
Mol.Wt. 159.61
 mg Calculate
Cupric sulfate monohydrate (% Cu = 35.78)
Mol.Fml.CuSO4.H20
Mol.Wt. 177.61
 mg Calculate
Cupric sufate pentahydrate (% Cu = 25.46)
Mol.Fml.CuSo4.5H2O
Mol.Wt. 249.61
 mg Calculate

Manganese aspartate (% Mn = 17.2)
Mol.Fml.C8H14N2O8Mn
Mol.Wt.320.94
 mg Calculate
Manganese chloride (% Mn = 27.8)
Mol.Fml.MnCl2.4H2O
Mol.Wt.197.9
 mg Calculate
Manganese gluconate (% Mn = 11.4 - 12.4)
Mol.Fml.C12H22MnO4.XH2O
Mol.Wt.445.2
 mg Calculate
Manganese glycerophosphate (% Mn = 24.4)
Mol.Fml.C3H7MnO6P.XH2O
Mol.Wt.445.2
 mg Calculate
Manganese oxide (% Mn = 72.0)
Mol.Fml.Mn3O4
Mol.Wt.228.8
 mg Calculate
Manganese sulfate (% Mn = 24.6)
Mol.Fml.MnSO4.4H2O
Mol.Wt.223.1
 mg Calculate
Manganese sulfate monohydrate (% Mn = 32.5)
Mol.Fml.MnSO4.H2O
Mol.Wt.169.0
 mg Calculate

Molybdenum trioxide (% Mo = 66.65)
Mol.Fml.MoO3
Mol.Wt.143.9
 mg Calculate
Sodium molybdate (% Mo = 46.6)
Mol.Fml.MoNa2O4
Mol.Wt.205.92
 mg Calculate

Potassium iodide (% K = 23.6, % I = 76.4)
Mol.Fml.KI
Mol.Wt.166
 mg Calculate
 mg Iodine
 mg Potassium

Sodium ascorbate (% Na = 11.6)
Mol.Fml.C6H7NaO2
Mol.Wt.198.1
 mg Calculate
Sodium bicarbonate (% Na = 27.4)
Mol.Fml.NaHCO3
Mol.Wt.84.0
 mg Calculate
 
Sodium chloride (% Na = 39.3)
Mol.Fml.NaCl
Mol.Wt.58.44
 mg Calculate
Sodium citrate (% Na = 23.5)
Mol.Fml.C6H5Na3O7.2H2O
Mol.Wt.294.1
 mg Calculate
Sodium citrate anhydrous (% Na = 26.7)
Mol.Fml.C6H5Na3O7
Mol.Wt.258.07
 mg Calculate
Sodium glycerophosphate (% Na = 21.3)
Mol.Fml.C3H7Na2O6P.XH2O
Mol.Wt.248.26
 mg Calculate
Sodium molybdate (% Mo = 46.6)
Mol.Fml.MoNa2O4
Mol.Wt.206.0
 mg Calculate
Sodium phosphate - dibasic (% Na = 17.2)
Mol.Fml.Na2HPO4.H2O
 mg Calculate
Sodium phosphate - dibasic dihydrate (% Na = 25.83, % P = 17.40)
Mol.Fml.Na2HPO4.2H20
Mol.Wt.178.00
 mg Calculate
mg Sodium
mg Phosphorus
Sodium phosphate - dibasic dodecahydrate (% Na= 12.84, % P= 8.65)
Mol.Fml.Na2HPO4.12H20
Mol.Wt.358.14
 mg Calculate
 mg Sodium
 mg Phosphorus
Sodium phosphate - dibasic monohydrate (% Na = 28.74, % P = 19.36)
Mol.Fml.Na2HPO4.H20
Mol.Wt.159.94
 mg Calculate
 mg Sodium
 mg Phosphorus
Sodium phosphate - monobasic (% Na = 19.16, % P = 25.8)
Mol.Fml.NaH2PO4
Mol.Wt.120
 mg Calculate
 mg Sodium
 mg Phosphorus
Sodium phosphate - monobasic dihydrate ( % Na = 14.74, % P = 19.85)
Mol.Fml.NaH2PO4.2H2O
Mol.Wt.156.02
 mg Calculate
 mg Sodium
 mg Phosphorus
Sodium phosphate - tribasic (% Na = 18.14, % P= 8.15)
Mol.Fml.Na3PO4.XH2O
Mol.Wt.164.94
 mg Calculate
 mg Sodium
 mg Phosphorus
Sodium sulfate anhydrous (% Na = 32.4)
Mol.Fml.Na2SO4
Mol.Wt.142.06
mg Calculate
Sodium phosphate- dibasic anhydrous (% Na = 32.39, % P = 21.82)
Mol.Fml.Na2PO4
Mol.Wt.141.96
 mg Calculate
 mg Sodium
 mg Phosphorus

Selenomethionine (% Se = 40.26)
Mol.Fml.C5H11NO2Se
Mol.Wt.196.11M
 mg Calculate
Selenocysteine (% Se = 46.98)
Mol.Fml.C3H7NO2Se
Mol.Wt.168.05
 mg Calculate
Sodium selenite pentahydrate ( % Se = 30)
Mol.Fml.Na2O3 Se.5H2O
Mol.Wt.263
 mg Calculate
Sodium selenite (% Se = 45.66)
Mol.Fml.Na2O3 Se
Mol.Wt.172.9
 mg Calculate
Sodium selenate (% Se = 41.8)
Mol.Fml.NaO4Se
Mol.Wt.188.94
 mg Calculate

Silica - colloidal anhydrous (% Si = 46.7)
Mol.Fml.SiO2
Mol.Wt.60.1
 mg Calculate
Silicon dioxide (% Si = 46.7)
Mol.Fml.SiO2
Mol.Wt.60.1
 mg Calculate